Home
Products
Acetagastrodin
| Product Name | Acetagastrodin |
| Price: | Inquiry |
| Catalog No.: | CN03475 |
| CAS No.: | 64291-41-4 |
| Molecular Formula: | C21H26O11 |
| Molecular Weight: | 454.43 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The herbs of Gastrodia elata |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCc1ccc(cc1)O[C@@H]1O[C@H](COC(=O)C)[C@H]([C@@H]([C@H]1OC(=O)C)OC(=O)C)OC(=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Acetagastrodin (compound 4) is an intermediate for the synthesis of DBPG (an antioxidant from Origanum vulgare)[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 551.4±50.0 °C at 760 mmHg |
| Flash Point | 184.0±23.6 °C |
| Exact Mass | 454.147522 |
| PSA | 143.89000 |
| LogP | 1.74 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Storage condition | 2-8C |