Home
Products
L-Quebrachitol
| Product Name | L-Quebrachitol |
| Price: | $100 / 20mg |
| Catalog No.: | CN06556 |
| CAS No.: | 642-38-6 |
| Molecular Formula: | C7H14O6 |
| Molecular Weight: | 194.18 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The barks of Aspidosperma desmanthum |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | CO[C@@H]1[C@H](O)[C@@H](O)[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | L-Quebrachitol is a natural product isolated from many plants, promotes osteoblastogenesis by uppregulation of BMP-2, runt-related transcription factor-2 (Runx2), MAPK (ERK, JNK, p38α), and Wnt/β-catenin signaling pathway[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 317.2±42.0 °C at 760 mmHg |
| Flash Point | 145.6±27.9 °C |
| Exact Mass | 194.079041 |
| PSA | 110.38000 |
| LogP | -0.74 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Storage condition | 2-8°C |