Home
Products
Alloimperatorin
| Product Name | Alloimperatorin |
| Price: | $190 / 10mg |
| Catalog No.: | CN06064 |
| CAS No.: | 642-05-7 |
| Molecular Formula: | C16H14O4 |
| Molecular Weight: | 270.28 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The herbs of Angelica dahurica |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCc1c2ccc(=O)oc2c(c2c1cco2)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Alloimperatorin (Prangenidin), a coumarin compound, is extracted from Angelica dahurica. Alloimperatorin (Prangenidin) has antitumor activity[1][2]. |
| Density | 1.298g/cm3 |
| Boiling Point | 476.1ºC at 760 mmHg |
| Flash Point | 241.8ºC |
| Exact Mass | 270.08900 |
| PSA | 63.58000 |
| LogP | 3.75350 |
| Storage condition | 2-8℃ |