Home
Products
alpha-Amyrin
| Product Name | alpha-Amyrin |
| Price: | $263 / 5mg |
| Catalog No.: | CN07661 |
| CAS No.: | 638-95-9 |
| Molecular Formula: | C30H50O |
| Molecular Weight: | 426.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Artemisia vulgaris |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C[C@@H]1CC[C@]2([C@@H]([C@H]1C)C1=CC[C@H]3[C@@]([C@@]1(CC2)C)(C)CC[C@@H]1[C@]3(C)CC[C@@H](C1(C)C)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | α-Amyrin is a pentacyclic triterpenoid. α-Amyrin has long-lasting antinociceptive and anti-inflammatory properties. α-Amyrin can be used for the research of inflammatory[1]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 493.8±45.0 °C at 760 mmHg |
| Flash Point | 218.6±21.0 °C |
| Exact Mass | 426.386169 |
| PSA | 20.23000 |
| LogP | 11.01 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Storage condition | 2-8℃ |