Home
Products
Coniferyl ferulate
| Product Name | Coniferyl ferulate |
| Price: | $146 / 20mg |
| Catalog No.: | CN06794 |
| CAS No.: | 63644-62-2 |
| Molecular Formula: | C20H20O6 |
| Molecular Weight: | 356.37 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Oil |
| Source: | The herbs of Ligusticum chuanxiong Hort. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(/C=C/COC(=O)/C=C/c2ccc(c(c2)OC)O)ccc1O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Use of Coniferyl ferulate | Coniferyl ferulate, a strong inhibitor of glutathione S-transferase (GST) isolated from Radix Angelicae sinensis, reverses multidrug resistance and downregulates P-glycoprotein. Coniferyl ferulate shows strong inhibition of human placental GST with an IC50 of 0.3 μM[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 570.5±50.0 °C at 760 mmHg |
| Flash Point | 202.8±23.6 °C |
| Exact Mass | 356.125977 |
| Storage condition | 2-8C |
| HS Code | 2918990090 |