Home
Products
4-Hydroxyisophthalic acid
| Product Name | 4-Hydroxyisophthalic acid |
| Price: | Inquiry |
| Catalog No.: | CN03355 |
| CAS No.: | 636-46-4 |
| Molecular Formula: | C8H6O5 |
| Molecular Weight: | 182.1 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The roots of Decalepis hamiltonii |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC(=O)c1ccc(c(c1)C(=O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 447.5±40.0 °C at 760 mmHg |
| Flash Point | 238.6±23.8 °C |
| Exact Mass | 182.021530 |
| PSA | 94.83000 |
| LogP | 2.09 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |