Home
Products
Microhelenin C
| Product Name | Microhelenin C |
| Price: | $556 / 10mg |
| Catalog No.: | CN09067 |
| CAS No.: | 63569-07-3 |
| Molecular Formula: | C20H26O5 |
| Molecular Weight: | 346.42 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Centipeda minima |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C=C(/C(=O)O[C@H]1[C@H]2[C@@H](C[C@H]([C@H]3[C@@]1(C)C(=O)C=C3)C)OC(=O)[C@H]2C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Microhelenin C is a sesquiterpene lactone isolated from Helenium microcephalum, with antitumor activity[1]. |
| Exact Mass | 346.17800 |
| PSA | 69.67000 |
| LogP | 2.84330 |