Home
Products
Rebaudioside C
| Product Name | Rebaudioside C |
| Price: | $54 / 20mg |
| Catalog No.: | CN08708 |
| CAS No.: | 63550-99-2 |
| Molecular Formula: | C44H70O22 |
| Molecular Weight: | 951.02 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The leaves of Stevia rebaudiana Bertoni. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@@]23CC[C@@H]4[C@@](C2)(CC3=C)CC[C@H]2[C@@]4(C)CCC[C@@]2(C)C(=O)O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)[C@@H]([C@H]([C@@H]1O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Rebaudioside C(Dulcoside B) is used as natural sweeteners to diabetics and others on carbohydrate-controlled diets. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 1070.0±65.0 °C at 760 mmHg |
| Flash Point | 310.5±27.8 °C |
| Exact Mass | 950.435852 |
| PSA | 353.90000 |
| LogP | 1.82 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Storage condition | -20°C |