Home
Products
Bilirubin
| Product Name | Bilirubin |
| Price: | $37 / 20mg |
| Catalog No.: | CN02127 |
| CAS No.: | 635-65-4 |
| Molecular Formula: | C33H36N4O |
| Molecular Weight: | 584.66 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The bile of Pig |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=CC1=C(C)/C(=C/c2[nH]c(c(c2C)CCC(=O)O)Cc2[nH]c(c(c2CCC(=O)O)C)/C=C/2NC(=O)C(=C2C=C)C)/NC1=O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Bilirubin is a yellow breakdown product of heme catabolism. |
| Target | Human Endogenous Metabolite |
| In Vitro | Unconjugated Bilirubin inhibits the cleavage of F485-rVWF73-H, D633-rVWF73-H, and GST-rVWF71-11K by ADAMTS13 in a concentration-dependent manner with a half-maximal inhibitory concentration (IC50) of ~13 μM, ~70 μM, and ~17 μM, respectively. Unconjugated Bilirubin also dose-dependently inhibits the cleavage of multimeric VWF by ADAMTS13 under denaturing conditions[1]. Bilirubin exhibits antioxidant and antimutagenic effects in vitro[2]. |
| Density | 1.2163 |
| Boiling Point | 641.7°C |
| Flash Point | 478.1±37.1 °C |
| Exact Mass | 584.263489 |
| PSA | 164.38000 |
| LogP | 3.15 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | −20°C |