Home
Products
Berberine hydrogen sulphate
| Product Name | Berberine hydrogen sulphate |
| Price: | Inquiry |
| Catalog No.: | CN01298 |
| CAS No.: | 633-66-9 |
| Molecular Formula: | C20H19NO8S |
| Molecular Weight: | 433.43 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Coptis chinensis Franch. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | [O-]S(=O)(=O)O.COc1c(OC)ccc2c1c[n+]1CCc3c(c1c2)cc1c(c3)OCO1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Berberine sulfate is a natural alkaline, reduces apoptosis, with potent anti-oxidative and anti-inflammatory effect[1]. |
| Exact Mass | 433.083130 |
| PSA | 126.61000 |
| LogP | 3.18170 |
| Storage condition | 2-8C |