Home
Products
Hypaconine
| Product Name | Hypaconine |
| Price: | Inquiry |
| Catalog No.: | CN00771 |
| CAS No.: | 63238-68-6 |
| Molecular Formula: | C24H39NO8 |
| Molecular Weight: | 469.57 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Aconitum kusnezoffii Reichb. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC[C@]12CC[C@@H](C34[C@@H]2[C@@H](OC)C(C3N(C1)C)[C@@]1([C@@H]2[C@H]4C[C@@]([C@@H]2O)([C@H]([C@@H]1O)OC)O)O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Hypaconine is a C19-diterpenoid alkaloid isolated from Aconitum and Delphinium spp. Hypaconine exhibits strong cardiac activity[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 573.1±50.0 °C at 760 mmHg |
| Flash Point | 300.4±30.1 °C |
| Exact Mass | 469.267578 |
| LogP | -1.10 |
| Vapour Pressure | 0.0±3.6 mmHg at 25°C |