Home
Products
Benzoylmesaconine
| Product Name | Benzoylmesaconine |
| Price: | Inquiry |
| Catalog No.: | CN02030 |
| CAS No.: | 63238-67-5 |
| Molecular Formula: | C31H43NO10 |
| Molecular Weight: | 589.68 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The branch roots of Aconitum carmichaeli Debx. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC[C@@]12CN(C)C3C4([C@@H]2[C@@H](OC)C3[C@@]2([C@@H]3[C@H]4C[C@@]([C@@H]3OC(=O)c3ccccc3)([C@H]([C@@H]2O)OC)O)O)[C@H](C[C@H]1O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Benzoylmesaconine is the most abundant component of Wutou decoction, which is widely used in China because of its therapeutic effect on rheumatoid arthritis. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 703.2±60.0 °C at 760 mmHg |
| Flash Point | 379.1±32.9 °C |
| Exact Mass | 589.288696 |
| PSA | 147.38000 |
| LogP | 0.37 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Storage condition | 2~8℃ |