Home
Products
Benzoylhypacoitine
| Product Name | Benzoylhypacoitine |
| Price: | Inquiry |
| Catalog No.: | CN01078 |
| CAS No.: | 63238-66-4 |
| Molecular Formula: | C31H43NO9 |
| Molecular Weight: | 573.29 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Aconitum carmichaeli Debx. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC[C@]12CC[C@@H](C34[C@@H]2[C@@H](OC)C(C3N(C1)C)[C@@]1([C@@H]2[C@H]4C[C@@]([C@@H]2OC(=O)c2ccccc2)([C@H]([C@@H]1O)OC)O)O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Benzoylhypaconine is a natural product. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 663.6±55.0 °C at 760 mmHg |
| Flash Point | 355.1±31.5 °C |
| Exact Mass | 573.293762 |
| PSA | 127.15000 |
| LogP | 1.43 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Storage condition | 2-8°C |