Home
Products
Quillaic acid
| Product Name | Quillaic acid |
| Price: | $161 / 20mg |
| Catalog No.: | CN07457 |
| CAS No.: | 631-01-6 |
| Molecular Formula: | C30H46O5 |
| Molecular Weight: | 486.69 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The barks of Quillaja saponaria. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C[C@]1(C)[C@@H](O)CC[C@]2([C@H]1CC[C@@]1([C@@H]2CC=C2[C@@]1(C)C[C@@H](O)[C@@]1([C@H]2CC(CC1)(C)C)C(=O)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Quillaic acid(Quillaja sapogenin) is the major aglycone of the widely studied saponins of the Chilean indigenous tree Quillaja saponaria Mol; can elicit dose-dependent antinociceptive effects in two murine thermal models. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 613.3±55.0 °C at 760 mmHg |
| Flash Point | 338.7±28.0 °C |
| Exact Mass | 486.334534 |
| PSA | 94.83000 |
| LogP | 6.08 |
| Vapour Pressure | 0.0±4.0 mmHg at 25°C |