Home
Products
Senkyunolide
| Product Name | Senkyunolide |
| Price: | $85 / 20mg |
| Catalog No.: | CN06504 |
| CAS No.: | 63038-10-8 |
| Molecular Formula: | C12H16O2 |
| Molecular Weight: | 192.11 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Oil |
| Source: | The roots of Ligusticum chuanxiong hort |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCCC[C@@H]1OC(=O)C2=C1CCC=C2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Senkyunolide A, isolated from Ligusticum chuanxiong Hort, has cytoprotective and antiproliferative activities. Anti-tumor activity[1][2]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 368.1±11.0 °C at 760 mmHg |
| Flash Point | 154.2±16.7 °C |
| Exact Mass | 192.115036 |
| PSA | 26.30000 |
| LogP | 2.48 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Storage condition | 2-8℃ |