Home
Products
g-Strophanthin
| Product Name | g-Strophanthin |
| Price: | Inquiry |
| Catalog No.: | CN02287 |
| CAS No.: | 630-60-4 |
| Molecular Formula: | C29H44O12 |
| Molecular Weight: | 584.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The herbs of Thevetia peruviana |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@@]12[C@H](O)C[C@H](C[C@@]2(O)CC[C@@H]2[C@@H]1[C@H](O)C[C@]1([C@]2(O)CC[C@@H]1C1=CC(=O)OC1)C)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.1941 (rough estimate) |
| Boiling Point | 561.69°C (rough estimate) |
| Exact Mass | 584.28300 |
| PSA | 206.60000 |
| Storage condition | Desiccate at -20°C |