Home
Products
Gomisin G
| Product Name | Gomisin G |
| Price: | Inquiry |
| Catalog No.: | CN02924 |
| CAS No.: | 62956-48-3 |
| Molecular Formula: | C30H32O9 |
| Molecular Weight: | 536.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The fruits of Schizandra chinensis. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c2OCOc2cc2c1c1c(C[C@@H]([C@]([C@H]2OC(=O)c2ccccc2)(C)O)C)cc(c(c1OC)OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Gomisin G is an ethanolic extract of the stems of Kadsura interior; exhibits potent anti-HIV activity with EC50 and therapeutic index (TI) values of 0.006 microgram/mL and 300, respectively. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 670.9±55.0 °C at 760 mmHg |
| Flash Point | 217.2±25.0 °C |
| Exact Mass | 536.204651 |
| PSA | 101.91000 |
| LogP | 6.38 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Storage condition | 2-8℃ |