Home
Products
6-Methoxy-4-methylcoumarin
| Product Name | 6-Methoxy-4-methylcoumarin |
| Price: | Inquiry |
| Catalog No.: | CN06132 |
| CAS No.: | 6295-35-8 |
| Molecular Formula: | C11H10O3 |
| Molecular Weight: | 190.20 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The herbs of Eupatorium pauciflorum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc2c(c1)c(C)cc(=O)o2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 351.6±37.0 °C at 760 mmHg |
| Flash Point | 146.3±21.1 °C |
| Exact Mass | 190.062988 |
| PSA | 39.44000 |
| LogP | 2.49 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |