Home
Products
Xanthoangelol
| Product Name | Xanthoangelol |
| Price: | $293 / 10mg |
| Catalog No.: | CN05613 |
| CAS No.: | 62949-76-2 |
| Molecular Formula: | C25H28O4 |
| Molecular Weight: | 392.49 g/mol |
| Purity: | >=98% |
| Type of Compound: | Chalcones |
| Physical Desc.: | Powder |
| Source: | The herbs of Ashitaba (Angelica keiskei Koidzumi) |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C(=CCc1c(O)ccc(c1O)C(=O)/C=C/c1ccc(cc1)O)/CCC=C(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Xanthoangelol, extracted from Angelica keiskei, suppresses obesity-induced inflammatory responses. Xanthoangelol possesses antibacterial activity[1][2]. Xanthoangelol and inhibits monoamine oxidases[3]. Xanthoangelol induces apoptosis in neuroblastoma and leukemia cells[4]. |
| Density | 1.165g/cm3 |
| Boiling Point | 605.8ºC at 760 mmHg |
| Flash Point | 334.2ºC |
| Exact Mass | 392.19900 |
| PSA | 77.76000 |
| LogP | 5.93470 |