Home
Products
1,1,1,1-Kestohexaose
| Product Name | 1,1,1,1-Kestohexaose |
| Price: | $146 / 10mg |
| Catalog No.: | CN06355 |
| CAS No.: | 62512-19-0 |
| Molecular Formula: | C36H62O31 |
| Molecular Weight: | 990.9 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The herbs of Hordeum vulgare L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@H]1O[C@]([C@H]([C@@H]1O)O)(OC[C@@]1(OC[C@@]2(O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O)O[C@@H]([C@H]([C@@H]2O)O)CO)O[C@@H]([C@H]([C@@H]1O)O)CO)CO[C@]1(CO[C@]2(CO)O[C@@H]([C@H]([C@@H]2O)O)CO)O[C@@H]([C@H]([C@@H]1O)O)CO |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 1,1,1,1-Kestohexaose is a fructan oligomer isolated from Poa ampla[1]. |
| Density | 1.88±0.1 g/cm3 |
| Boiling Point | 1359.3±65.0℃ at 760 mmHg |
| Exact Mass | 990.32800 |
| PSA | 506.13000 |