Home
Products
Parishin A
| Product Name | Parishin A |
| Price: | $62 / 20mg |
| Catalog No.: | CN03733 |
| CAS No.: | 62499-28-9 |
| Molecular Formula: | C45H56O25 |
| Molecular Weight: | 996.9 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Gastrodia elata |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2ccc(cc2)COC(=O)C(CC(=O)OCc2ccc(cc2)O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)(CC(=O)OCc2ccc(cc2)O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Parishin is a phenolic glucoside isolated from Gastrodia elata. Parishin exhibits antiaging effects and extends the lifespan of yeast via regulation of Sir2/Uth1/TOR signaling pathway[1]. |
| Target | Sir2/Uth1/TOR[1] |
| In Vitro | Parishin extends the replicative lifespan of K6001 yeast at 3, 10, and 30 μM[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 1137.0±65.0 °C at 760 mmHg |
| Flash Point | 330.0±27.8 °C |
| Exact Mass | 996.311096 |
| PSA | 397.27000 |
| LogP | -3.37 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |