Home
Products
epsilon-Viniferin
| Product Name | epsilon-Viniferin |
| Price: | $293 / 5mg |
| Catalog No.: | CN03993 |
| CAS No.: | 62218-08-0 |
| Molecular Formula: | C28H22O6 |
| Molecular Weight: | 454.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Solid |
| Source: | The stems of Gnetum montanum Markgr. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc(cc1)/C=C/c1cc(O)cc2c1[C@@H](c1cc(O)cc(c1)O)[C@@H](O2)c1ccc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | ε-Viniferin, the dimer of Resveratrol and isolated from Vitis vinifera, displays a potent inhibitory for all the CYP activities, with Ki values from 0.5-20 μM. ε-Viniferin possesses potent antioxidant capacity[1][2]. |
| Target | CYP2B6:3 μM (Ki, (BROD)) CYP1A2:5 μM (Ki, (EROD)) CYP3A4:10 μM (Ki, (TST)) CYP4A:15 μM (IC50, (LwOH)) CYP2E1:25 μM (IC50, (CHZ)) CYP2A6:60 μM (Ki, (COH)) |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 694.8±55.0 °C at 760 mmHg |
| Flash Point | 374.0±31.5 °C |
| Exact Mass | 454.141632 |
| PSA | 110.38000 |
| LogP | 4.60 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |