Home
Products
(-)-Syringaresinol
| Product Name | (-)-Syringaresinol |
| Price: | $117 / 10mg |
| Catalog No.: | CN02867 |
| CAS No.: | 6216-81-5 |
| Molecular Formula: | C22H26O8 |
| Molecular Weight: | 418.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Polygonatum kingianum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(cc(c1O)OC)[C@@H]1OC[C@@H]2[C@H]1CO[C@H]2c1cc(OC)c(c(c1)OC)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (-)-Syringaresinol, found in stems of Annona Montana, possesses anti-cancer activity[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 594.7±50.0 °C at 760 mmHg |
| Flash Point | 313.5±30.1 °C |
| Exact Mass | 418.162781 |
| PSA | 95.84000 |
| LogP | 0.71 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |