Home
Products
Tricaprin
| Product Name | Tricaprin |
| Price: | Inquiry |
| Catalog No.: | CN06424 |
| CAS No.: | 621-71-6 |
| Molecular Formula: | C33H62O6 |
| Molecular Weight: | 554.9 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Oil |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC)COC(=O)CCCCCCCCC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tricaprin (Glyceryl tridecanoate) is an orally available precursor of decanoic acid (DA) and can be hydrolyzed to DA. Tricaprin (Glyceryl tridecanoate) is a major component of medium chain triglyceride (MCT) with antiandrogen and antihyperglycemic properties[1].Tricaprin (Glyceryl tridecanoate) has a safe use in in foods, drugs, cosmetics as an additive[2]. |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 578.6±17.0 °C at 760 mmHg |
| Flash Point | 233.3±21.0 °C |
| Exact Mass | 554.454651 |
| PSA | 78.90000 |
| LogP | 12.52 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Storage condition | −20°C |