Home
Products
3-Nitro-L-tyrosine
| Product Name | 3-Nitro-L-tyrosine |
| Price: | Inquiry |
| Catalog No.: | CN01979 |
| CAS No.: | 621-44-3 |
| Molecular Formula: | C9H10N2O5 |
| Molecular Weight: | 226.19 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Colorless cryst. |
| Source: | |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC(=O)[C@H](Cc1ccc(c(c1)[N+](=O)[O-])O)N |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3-Nitro-L-tyrosine is a biomarker of nitrogen free radical species modified proteins in systemic autoimmunogenic conditions. |
| Target | Human Endogenous Metabolite |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 431.6±45.0 °C at 760 mmHg |
| Flash Point | 214.8±28.7 °C |
| Exact Mass | 226.058975 |
| PSA | 129.37000 |
| LogP | 0.60 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Storage condition | 2~8℃ |