Home
Products
Hydroxycitric acid
| Product Name | Hydroxycitric acid |
| Price: | Inquiry |
| Catalog No.: | CN06547 |
| CAS No.: | 6205-14-7 |
| Molecular Formula: | C6H8O8 |
| Molecular Weight: | 208.12 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The fruits of Garcinia atroviridis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC(=O)CC(C(C(=O)O)O)(C(=O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Hydroxycitric acid is a natural antiobesity agent, that can be isolated from the fruits of Garcinia gummi-gutta (L.) Roxb[1]. |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 393.3±42.0 °C at 760 mmHg |
| Flash Point | 205.8±24.4 °C |
| Exact Mass | 208.021912 |
| PSA | 152.36000 |
| LogP | -1.35 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |