Home
Products
Helichrysetin
| Product Name | Helichrysetin |
| Price: | $351 / 5mg |
| Catalog No.: | CN05674 |
| CAS No.: | 62014-87-3 |
| Molecular Formula: | C16H14O5 |
| Molecular Weight: | 286.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Chalcones |
| Physical Desc.: | Yellow powder |
| Source: | The fruits of Alpinia katsumadai Hayata. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)cc(c1C(=O)/C=C/c1ccc(cc1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Helichrysetin, isolated from the flowers of Helichrysum odoratissimum, is an ID2 (inhibitor of DNA binding 2) inhibitor, and suppresses DCIS (ductal carcinoma in situ) formation. Helichrysetin possess strong inhibitory effects on cell growth and is capable of inducing apoptosis in A549 cells[1][2]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 532.0±50.0 °C at 760 mmHg |
| Flash Point | 201.0±23.6 °C |
| Exact Mass | 286.084137 |
| PSA | 86.99000 |
| LogP | 3.08 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |