Home
Products
Hyoscyamine sulfate hydrate
| Product Name | Hyoscyamine sulfate hydrate |
| Price: | $46 / 20mg |
| Catalog No.: | CN01073 |
| CAS No.: | 620-61-1 |
| Molecular Formula: | (C17H23NO3)2.H2SO4.H2O |
| Molecular Weight: | 694.83 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Anisodus tanguticus |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OS(=O)(=O)O.OC[C@H](c1ccccc1)C(=O)O[C@@H]1C[C@@H]2CC[C@H](C1)N2C.OC[C@H](c1ccccc1)C(=O)O[C@@H]1C[C@@H]2CC[C@H](C1)N2C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | L-Hyoscyamine sulfate (Daturine sulfate) is a tropane alkaloid that is a secondary metabolite found in certain plants of the solanaceae family. In vitro it has been shown to be an antagonist of mAChR[1]. |
| Exact Mass | 676.302979 |
| PSA | 191.75000 |
| LogP | 4.10130 |