Home
Products
4-Nitrocinnamic acid
| Product Name | 4-Nitrocinnamic acid |
| Price: | Inquiry |
| Catalog No.: | CN06978 |
| CAS No.: | 619-89-6 |
| Molecular Formula: | C9H7NO4 |
| Molecular Weight: | 193.16 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Yellow cryst. |
| Source: | The heartwoods of Cassia garrettiana |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC(=O)C=Cc1ccc(cc1)[N+](=O)[O-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 346.0±17.0 °C at 760 mmHg |
| Flash Point | 153.9±9.4 °C |
| Exact Mass | 193.037506 |
| PSA | 83.12000 |
| LogP | 2.19 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |