Home
Products
Helicin
| Product Name | Helicin |
| Price: | $54 / 20mg |
| Catalog No.: | CN03356 |
| CAS No.: | 618-65-5 |
| Molecular Formula: | C13H16O7 |
| Molecular Weight: | 284.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2ccccc2C=O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Helicin, found in Rosaceae, is a moderate syrB inducer. Helicon can be hydrolyzed by BglY enzyme[1][2]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 552.0±50.0 °C at 760 mmHg |
| Flash Point | 212.6±23.6 °C |
| Exact Mass | 284.089600 |
| PSA | 116.45000 |
| LogP | -1.44 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |