Home
Products
Ethyl 3,4,5-trimethoxybenzoate
| Product Name | Ethyl 3,4,5-trimethoxybenzoate |
| Price: | Inquiry |
| Catalog No.: | CN03775 |
| CAS No.: | 6178-44-5 |
| Molecular Formula: | C12H16O5 |
| Molecular Weight: | 240.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The herbs of Rauvolfia verticillata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCOC(=O)c1cc(OC)c(c(c1)OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ethyl 3,4,5-trimethoxybenzoate is a natural compound isolated from the roots of Rauvolfia yunnanensis Tsiang[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 292.0±7.0 °C at 760 mmHg |
| Flash Point | 123.4±18.2 °C |
| Exact Mass | 240.099777 |
| PSA | 53.99000 |
| LogP | 2.27 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |