Home
Products
2-Hydroxy-1-methoxyanthraquinone
| Product Name | 2-Hydroxy-1-methoxyanthraquinone |
| Price: | $819 / 2mg |
| Catalog No.: | CN05972 |
| CAS No.: | 6170-06-5 |
| Molecular Formula: | C15H10O4 |
| Molecular Weight: | 254.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Yellow powder |
| Source: | The roots of Morinda officinalis. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(O)ccc2c1C(=O)c1c(C2=O)cccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 2-Hydroxy-1-methoxyanthraquinone could be isolated from the stem bark of Morinda lucida Benth. (Rubiaceae) and possesses antibacterial activity[1]. |
| Density | 1.400±0.06 g/cm3 (20 ºC 760 Torr) |
| Exact Mass | 254.05800 |
| PSA | 63.60000 |
| LogP | 2.17620 |