Home
Products
Acetylatractylodinol
| Product Name | Acetylatractylodinol |
| Price: | $453 / 5mg |
| Catalog No.: | CN06509 |
| CAS No.: | 61582-39-6 |
| Molecular Formula: | C15H12O3 |
| Molecular Weight: | 240.25 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The roots of Atractylodes chinensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)O.OC/C=C/C#CC#C/C=C/c1ccco1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Acetylatractylodinol, isolated from Atractylodes lancea, possesses antioxidant activity[1]. |
| Exact Mass | 258.08900 |
| PSA | 70.67000 |
| LogP | 1.93900 |