Home
Products
Griffonilide
| Product Name | Griffonilide |
| Price: | $117 / 20mg |
| Catalog No.: | CN06712 |
| CAS No.: | 61371-55-9 |
| Molecular Formula: | C8H8O4 |
| Molecular Weight: | 168.04 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | White cryst. |
| Source: | The roots of Semiaquilegia adoxoides (DC.) Makino |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1C=C2C(O1)C(O)C(C=C2)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Griffonilide is a butenolide, isolated from the roots of Semiaquilegia adoxoides, and often occurs alongside lithospermoside[1][2]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 491.2±45.0 °C at 760 mmHg |
| Flash Point | 212.4±22.2 °C |
| Exact Mass | 168.042252 |
| PSA | 66.76000 |
| LogP | -1.82 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Storage condition | -20C |