Home
Products
Isoacteoside
| Product Name | Isoacteoside |
| Price: | $85 / 20mg |
| Catalog No.: | CN06947 |
| CAS No.: | 61303-13-7 |
| Molecular Formula: | C29H36O15 |
| Molecular Weight: | 624.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Pedicularis striata Pall. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O=C(OC[C@H]1O[C@@H](OCCc2ccc(c(c2)O)O)[C@@H]([C@H]([C@@H]1O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)/C=C/c1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isoacteoside is a natural compound which exhibit significant inhibition of advanced glycation end product formation with IC50 values of 4.6-25.7 μM, compared with those of aminoguanidine (IC50=1,056 μM) and quercetin (IC50=28.4 μM) as positive controls.IC50 value:Target:In the rat lens aldose reductase assay, acteoside, isoacteoside, and poliumoside exhibited greater inhibitory effects on rat lens aldose reductase with IC50 values of 0.83, 0.83, and 0.85 μM, respectively, than those of the positive controls, 3,3-tetramethyleneglutaric acid (IC50=4.03 μM) and quercetin (IC50=7.2 μM). |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 942.9±65.0 °C at 760 mmHg |
| Flash Point | 306.1±27.8 °C |
| Exact Mass | 624.205444 |
| PSA | 245.29000 |
| LogP | 2.58 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8°C |