Home
Products
Schizandrin B
| Product Name | Schizandrin B |
| Price: | $31 / 20mg |
| Catalog No.: | CN02968 |
| CAS No.: | 61281-37-6 |
| Molecular Formula: | C23H28O6 |
| Molecular Weight: | 400.47 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The seeds of Schisandra chinensis (Turcz.) Baill. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2C[C@H](C)[C@H](C)Cc3c(c2c(c1OC)OC)c(OC)c1c(c3)OCO1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Schisandrin B(Wuweizisu-B) is a dibenzocyclooctadiene derivative isolated from Fructus Schisandrae, has been shown to produce antioxidant effect on rodent liver and heart.IC50 value:Target: in vitro: Schisandrin B exhibits anti-inflammatory activity through modulation of the redox-sensitive transcription factors Nrf2 and NF-κB. SB inhibited mitogen-induced proliferation and cytokine secretion by lymphocytes [1]. Sch B can protect neuronal cells against oxidative challenge, presumably by functioning as a hormetic agent to sustain cellular redox homeostasis and mitoenergetic capacity in neuronal cells [2]. Sch B exerted significant neuroprotective effects against microglial-mediated inflammatory injury in microglia-neuron co-cultures. Sch B significantly downregulated pro-inflammatory cytokines, including nitrite oxide (NO), tumor necrosis factor (TNF)-α, prostaglandin E(2) (PGE(2)), interleukin (IL)-1β and IL-6 [3]. Sch B could inhibit TGF-β induced EMT of 4T1 cells and of primary human breast cancer cells [4].in vivo: Similar anti-inflammatory effects of SB on lymphocyte proliferation and cytokine secretion were also observed in vivo [1]. Treatment with Sch B in CsA-treated mice significantly suppressed the elevation of blood urea nitrogen (BUN) and serum creatinine levels and attenuated the histopathological changes. Additionally, Sch B also decreased renal MDA levels and increased GSH levels in CsA-treated mice [5]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 545.0±50.0 °C at 760 mmHg |
| Flash Point | 220.4±30.0 °C |
| Exact Mass | 400.188599 |
| PSA | 55.38000 |
| LogP | 6.46 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |