Home
Products
Licoflavone A
| Product Name | Licoflavone A |
| Price: | $556 / 10mg |
| Catalog No.: | CN04502 |
| CAS No.: | 61153-77-3 |
| Molecular Formula: | C20H18O4 |
| Molecular Weight: | 322.36 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Glycyrrhiza inflata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCc1cc2c(=O)cc(oc2cc1O)c1ccc(cc1)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Licoflavone A is a flavonoid isolated from the roots of Glycyrrhiza uralensis, inhibits protein tyrosine phosphatase-1B (PTP1B), with an IC50 of 54.5 μM[1]. |
| Target | IC50: 54.5 μM (PTP1B)[1] |
| Density | 1.279±0.06 g/cm3(Predicted) |
| Boiling Point | 551.1±50.0 °C(Predicted) |
| Exact Mass | 322.12100 |
| PSA | 70.67000 |
| LogP | 4.37990 |