Home
Products
Scopolamine N-oxide hydrobromide
| Product Name | Scopolamine N-oxide hydrobromide |
| Price: | Inquiry |
| Catalog No.: | CN00619 |
| CAS No.: | 6106-81-6 |
| Molecular Formula: | C17H22BrNO5 |
| Molecular Weight: | 400.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Atropa belladonna L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@H](c1ccccc1)C(=O)O[C@@H]1C[C@@H]2[C@@H]3[C@H]([C@H](C1)[N]2(C)[O])O3.Br |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Scopolamine N-oxide hydrobromide is an antagonist of the muscarinic acetylcholine. |
| Target | muscarinic acetylcholine[1] |
| Exact Mass | 319.141968 |
| PSA | 88.49000 |
| LogP | -0.49 |