Home
Products
Tenuazonic acid
| Product Name | Tenuazonic acid |
| Price: | Inquiry |
| Catalog No.: | CN01806 |
| CAS No.: | 610-88-8 |
| Molecular Formula: | C10H15NO3 |
| Molecular Weight: | 197.23 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | From Alternaria alternata. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCC(C1NC(=O)C(=C1O)C(=O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tenuazonic acid, belonging to tetramic acids that are the largest family of natural products, is a putative nonhost-selective mycotoxin isolated from Alternaria alternate[1]. Tenuazonic acid blocks electron transport beyond primary quinone acceptor (QA) by interacting with D1 protein and it is a broad-spectrum and effective photosystem II (PSII) inhibitor[2]. |
| Target | PSII[2] |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 401.1±45.0 °C at 760 mmHg |
| Flash Point | 196.4±28.7 °C |
| Exact Mass | 197.105194 |
| PSA | 66.40000 |
| LogP | 0.81 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Storage condition | -20°C |