Home
Products
5'-Adenylic acid
| Product Name | 5'-Adenylic acid |
| Price: | $23 / 100mg |
| Catalog No.: | CN00079 |
| CAS No.: | 61-19-8 |
| Molecular Formula: | C10H14N5O7P |
| Molecular Weight: | 347.22 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@@H]1[C@H](O)[C@H](O[C@H]1n1cnc2c1ncnc2N)COP(=O)(O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Adenosine monophosphate is a key cellular metabolite regulating energy homeostasis and signal transduction. |
| Target | Human Endogenous Metabolite |
| In Vitro | Adenosine monophosphate is a product of various enzymatic reactions, many of which are dysregulated during disease conditions[1]. |
| Density | 2.3±0.1 g/cm3 |
| Boiling Point | 798.5±70.0 °C at 760 mmHg |
| Flash Point | 436.7±35.7 °C |
| Exact Mass | 347.063080 |
| PSA | 195.88000 |
| LogP | -0.22 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |