Home
Products
Dulcitol
| Product Name | Dulcitol |
| Price: | $15 / 20mg |
| Catalog No.: | CN06505 |
| CAS No.: | 608-66-2 |
| Molecular Formula: | C6H14O6 |
| Molecular Weight: | 182.07 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The herbs of Melampyrum nemorosum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@H]([C@@H]([C@@H]([C@H](CO)O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dulcite is a sugar alcohol with a slightly sweet taste which is a metabolic breakdown product of galactose. |
| Target | Human Endogenous Metabolite |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 494.9±0.0 °C at 760 mmHg |
| Flash Point | 292.5±23.3 °C |
| Exact Mass | 182.079041 |
| PSA | 121.38000 |
| LogP | -4.67 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Storage condition | Store at RT. |