Home
Products
Quercetin 3-O-beta-D-glucose-7-O-beta-D-gentiobioside
| Product Name | Quercetin 3-O-beta-D-glucose-7-O-beta-D-gentiobioside |
| Price: | $92 / 20mg |
| Catalog No.: | CN04635 |
| CAS No.: | 60778-02-1 |
| Molecular Formula: | C33H40O22 |
| Molecular Weight: | 788.66 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The seeds of Desurainia sophia. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OCC2OC(Oc3cc(O)c4c(c3)oc(c(c4=O)OC3OC(CO)C(C(C3O)O)O)c3ccc(c(c3)O)O)C(C(C2O)O)O)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Quercetin-3-O-β-D-glucose-7-O-β-D-gentiobiosiden is a flavonoid from Quercetin. |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 1189.6±65.0 °C at 760 mmHg |
| Flash Point | 371.7±27.8 °C |
| Exact Mass | 788.201111 |
| LogP | -1.89 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |