Home
Products
Sesamin
| Product Name | Sesamin |
| Price: | $15 / 20mg |
| Catalog No.: | CN02927 |
| CAS No.: | 607-80-7 |
| Molecular Formula: | C20H18O6 |
| Molecular Weight: | 354.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The seeds of Sesamum indicum. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C1OC2=CC=[CH](C=C2O1)[C@H]1OC[C@H]2[C@@H]1CO[C@@H]2c1ccc2c(c1)OCO2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sesamin, abundant lignan found in sesame oil, is a potent and selective delta 5 desaturase inhibitor in polyunsaturated fatty acid biosynthesis. Sesamin exerts effective neuroprotection against cerbral ischemia[1][2]. |
| Target | delta 5 desaturase[1] |
| In Vitro | Pretreated with sesamin, Excess generation of nitric oxide in lipopolysaccharide-stimulated rat primary microglia cells was significantly attenuated[1]. |
| In Vivo | Sesamin (o.p.; 20 mg/kg/day) significantly reduces the infarct size by approximately 50% in male gerbils (60-85 g)[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 504.4±50.0 °C at 760 mmHg |
| Flash Point | 212.3±30.0 °C |
| Exact Mass | 354.110352 |
| PSA | 55.38000 |
| LogP | 3.32 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Storage condition | −20°C |