Home
Products
2,4'-Dihydroxybenzophenone
| Product Name | 2,4'-Dihydroxybenzophenone |
| Price: | Inquiry |
| Catalog No.: | CN05789 |
| CAS No.: | 606-12-2 |
| Molecular Formula: | C13H10O3 |
| Molecular Weight: | 214.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Xanthones |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Garcinia xanthochymus |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc(cc1)C(=O)c1ccccc1O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.302 g/cm3 |
| Boiling Point | 383.6ºC at 760 mmHg |
| Flash Point | 200ºC |
| Exact Mass | 214.06300 |
| PSA | 57.53000 |
| LogP | 2.32880 |