Home
Products
Gomisin D
| Product Name | Gomisin D |
| Price: | $263 / 5mg |
| Catalog No.: | CN02925 |
| CAS No.: | 60546-10-3 |
| Molecular Formula: | C28H34O10 |
| Molecular Weight: | 530.56 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The fruits of Schizandra chinensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(OC)cc2c(c1OC)c1c3cc4c(c1OC[C@H]([C@@](C(=O)O[C@@H]2[C@@](C)(O)[C@H](C3)C)(C)O)C)OCO4 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Gomisin D, a lignan compound isolated from Fructus Schisandra, is a potential antidiabetic and anti-Alzheimer’s agent. Gomisin D inhibits UDP-Glucuronosyltransferases activity and scavenges ABTS(+) radicals. Gomisin D is used as a quality marker of Shengmai San and shenqi Jiangtang Granule[1]. |
| Target | UDP-Glucuronosyltransferases[1] |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 698.5±55.0 °C at 760 mmHg |
| Flash Point | 229.3±25.0 °C |
| Exact Mass | 530.215210 |
| PSA | 122.14000 |
| LogP | 3.95 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Storage condition | 2-8℃ |