Home
Products
Narcissoside
| Product Name | Narcissoside |
| Price: | $62 / 10mg |
| Catalog No.: | CN05484 |
| CAS No.: | 604-80-8 |
| Molecular Formula: | C28H32O16 |
| Molecular Weight: | 624.54 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The bulbus of Narcissus tazettaL. var. chinensis Roem. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COc1cc(ccc1O)c1oc2cc(O)cc(c2c(=O)c1O[C@@H]1O[C@H](CO[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)O)[C@H]([C@@H]([C@H]1O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Narcissin (Narcissoside), a flavonol glycoside isolated from Morinda citrifolia, exhibits evident scavenging activity against both authentic ONOO- and SIN-1-derived ONOO- with IC50s of 3.5 and 9.6 μM, respectively[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 953.1±65.0 °C at 760 mmHg |
| Flash Point | 312.9±27.8 °C |
| Exact Mass | 624.169006 |
| PSA | 258.43000 |
| LogP | 1.73 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | -20℃ |