Home
Products
Tamarixetin
| Product Name | Tamarixetin |
| Price: | $293 / 10mg |
| Catalog No.: | CN05286 |
| CAS No.: | 603-61-2 |
| Molecular Formula: | C16H12O7 |
| Molecular Weight: | 316.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Heracleum stenopterum. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1O)c1oc2cc(O)cc(c2c(=O)c1O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tamarixetin (4'-O-Methyl Quercetin) is a natural flavonoid derivative of quercetin, with anti-oxidative and anti-inflammatory effects. Tamarixetin protects against cardiac hypertrophy[1][2]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 601.8±55.0 °C at 760 mmHg |
| Flash Point | 228.8±25.0 °C |
| Exact Mass | 316.058289 |
| PSA | 120.36000 |
| LogP | 2.42 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |