Home
Products
Harmidol hydrochloride
| Product Name | Harmidol hydrochloride |
| Price: | $176 / 10mg |
| Catalog No.: | CN00711 |
| CAS No.: | 6028-07-5 |
| Molecular Formula: | C12H13ClN2O |
| Molecular Weight: | 236.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Peganum harmala L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc2c(c1)[nH]c1c2CCN=C1C.Cl |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Harmalol hydrochloride, a beta carboline alkaloid, presents in several medicinal plants such as Peganum harmala. Harmalol hydrochloride, main metabolite of Harmaline, significantly inhibits the dioxin-mediated induction of CYP1A1 at the transcriptional and posttranslational levels. Harmalol hydrochloride possesses antioxidant and hydroxyl radical-scavenging properties[1]. |
| Boiling Point | 507.5ºC at 760 mmHg |
| Flash Point | 231ºC |
| Exact Mass | 236.07200 |
| PSA | 48.38000 |
| LogP | 2.47620 |