Home
Products
1,2-dihydroxy-3-methyl-anthracene-9,10-dione
| Product Name | 1,2-dihydroxy-3-methyl-anthracene-9,10-dione |
| Price: | Inquiry |
| Catalog No.: | CN05964 |
| CAS No.: | 602-63-1 |
| Molecular Formula: | C15H10O4 |
| Molecular Weight: | 254.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Yellow cryst. |
| Source: | The leaves of Digitalis purpurea |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1c2ccccc2C(=O)c2c1c(O)c(c(c2)C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.476g/cm3 |
| Boiling Point | 460.3ºC at 760 mmHg |
| Flash Point | 246.3ºC |
| Exact Mass | 254.05800 |
| PSA | 74.60000 |
| LogP | 2.18160 |