Home
Products
Thiocolchicoside
| Product Name | Thiocolchicoside |
| Price: | $43 / 20mg |
| Catalog No.: | CN00028 |
| CAS No.: | 602-41-5 |
| Molecular Formula: | C27H33NO10S |
| Molecular Weight: | 563.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The bulbs of Colchicum autumnale L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc3CC[C@@H](c4c(c3c(c2OC)OC)ccc(c(=O)c4)SC)NC(=O)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Thiocolchicoside is a competitive γ-aminobutyric acid type A (GABAA) receptor antagonist and glycine receptor agonist in the central nervous system. Thiocolchicoside is a semisynthetic sulfur derivative of colchicoside. Thiocolchicoside is a muscle relaxant and has anti-inflammatory, and analgesic properties[1]. |
| Target | GABAA) receptor; glycine receptor[1] |
| In Vitro | Thiocolchicoside (0.001, 0.1, 1, 10, 100 μM) reduces the amplitude of eIPSCs in a concentration-dependent manner with this effect being significant at 0.1 μM and maximal at 10 μM[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 929.6±65.0 °C at 760 mmHg |
| Flash Point | 516.0±34.3 °C |
| Exact Mass | 563.182495 |
| PSA | 189.31000 |
| LogP | -1.23 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |